C27H29FN4O — CID 155734356
ethane;1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)-3-pyridin-4-ylindol-5-amine (PubChem CID 155734356) has the molecular formula C27H29FN4O and a molecular weight of 444.55 g/mol. Its IUPAC name is ethane;1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)-3-pyridin-4-ylindol-5-amine.
| Compound Name | ethane;1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)-3-pyridin-4-ylindol-5-amine |
|---|---|
| PubChem CID | 155734356 |
| Molecular Formula | C27H29FN4O |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | ethane;1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)-3-pyridin-4-ylindol-5-amine |
| SMILES | CC.[H]/N=C/c1cc2c(cc1N)c(-c1ccncc1)c(C1CCOCC1)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H23FN4O.C2H6/c26-19-1-3-20(4-2-19)30-23-13-18(15-27)22(28)14-21(23)24(16-5-9-29-10-6-16)25(30)17-7-11-31-12-8-17;1-2/h1-6,9-10,13-15,17,27H,7-8,11-12,28H2;1-2H3/b27-15+; |
| InChIKey | HFRIHHNAHINIPV-VVGWLSNUSA-N |
| XLogP | 6.33 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|