C26H20F3N3O2 — CID 156878952
4-[4-amino-2-(1-cyano-2-methylpropan-2-yl)-1-(3,4-difluorophenyl)-6-fluoroindol-3-yl]benzoic acid (PubChem CID 156878952) has the molecular formula C26H20F3N3O2 and a molecular weight of 463.46 g/mol. Its IUPAC name is 4-[4-amino-2-(1-cyano-2-methylpropan-2-yl)-1-(3,4-difluorophenyl)-6-fluoroindol-3-yl]benzoic acid.
| Compound Name | 4-[4-amino-2-(1-cyano-2-methylpropan-2-yl)-1-(3,4-difluorophenyl)-6-fluoroindol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 156878952 |
| Molecular Formula | C26H20F3N3O2 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 4-[4-amino-2-(1-cyano-2-methylpropan-2-yl)-1-(3,4-difluorophenyl)-6-fluoroindol-3-yl]benzoic acid |
| SMILES | CC(C)(CC#N)c1c(-c2ccc(C(=O)O)cc2)c2c(N)cc(F)cc2n1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C26H20F3N3O2/c1-26(2,9-10-30)24-22(14-3-5-15(6-4-14)25(33)34)23-20(31)11-16(27)12-21(23)32(24)17-7-8-18(28)19(29)13-17/h3-8,11-13H,9,31H2,1-2H3,(H,33,34) |
| InChIKey | NOGXWGCUQNVNTL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|