C27H26F2N2O3 — CID 156878338
4-[4-amino-6-fluoro-1-(4-fluoro-3-methylphenyl)-2-(1-methoxy-2-methylpropan-2-yl)indol-3-yl]benzoic acid (PubChem CID 156878338) has the molecular formula C27H26F2N2O3 and a molecular weight of 464.51 g/mol. Its IUPAC name is 4-[4-amino-6-fluoro-1-(4-fluoro-3-methylphenyl)-2-(1-methoxy-2-methylpropan-2-yl)indol-3-yl]benzoic acid.
| Compound Name | 4-[4-amino-6-fluoro-1-(4-fluoro-3-methylphenyl)-2-(1-methoxy-2-methylpropan-2-yl)indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 156878338 |
| Molecular Formula | C27H26F2N2O3 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-[4-amino-6-fluoro-1-(4-fluoro-3-methylphenyl)-2-(1-methoxy-2-methylpropan-2-yl)indol-3-yl]benzoic acid |
| SMILES | COCC(C)(C)c1c(-c2ccc(C(=O)O)cc2)c2c(N)cc(F)cc2n1-c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C27H26F2N2O3/c1-15-11-19(9-10-20(15)29)31-22-13-18(28)12-21(30)24(22)23(25(31)27(2,3)14-34-4)16-5-7-17(8-6-16)26(32)33/h5-13H,14,30H2,1-4H3,(H,32,33) |
| InChIKey | OEOYRWCGNLUYSE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|