C28H25F2N3O4 — CID 171577741
4-[8-fluoro-5-(4-fluoro-3-methylphenyl)-6-[(2S)-3,3,4,4,4-pentadeuterio-2-hydroxy-1-(trideuteriomethoxy)butan-2-yl]-1H-pyrrolo[2,3-f]indazol-7-yl]benzoic acid (PubChem CID 171577741) has the molecular formula C28H25F2N3O4 and a molecular weight of 513.57 g/mol. Its IUPAC name is 4-[8-fluoro-5-(4-fluoro-3-methylphenyl)-6-[(2S)-3,3,4,4,4-pentadeuterio-2-hydroxy-1-(trideuteriomethoxy)butan-2-yl]-1H-pyrrolo[2,3-f]indazol-7-yl]benzoic acid.
| Compound Name | 4-[8-fluoro-5-(4-fluoro-3-methylphenyl)-6-[(2S)-3,3,4,4,4-pentadeuterio-2-hydroxy-1-(trideuteriomethoxy)butan-2-yl]-1H-pyrrolo[2,3-f]indazol-7-yl]benzoic acid |
|---|---|
| PubChem CID | 171577741 |
| Molecular Formula | C28H25F2N3O4 |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 4-[8-fluoro-5-(4-fluoro-3-methylphenyl)-6-[(2S)-3,3,4,4,4-pentadeuterio-2-hydroxy-1-(trideuteriomethoxy)butan-2-yl]-1H-pyrrolo[2,3-f]indazol-7-yl]benzoic acid |
| SMILES | [2H]C([2H])([2H])OC[C@@](O)(c1c(-c2ccc(C(=O)O)cc2)c2c(F)c3[nH]ncc3cc2n1-c1ccc(F)c(C)c1)C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C28H25F2N3O4/c1-4-28(36,14-37-3)26-22(16-5-7-17(8-6-16)27(34)35)23-21(12-18-13-31-32-25(18)24(23)30)33(26)19-9-10-20(29)15(2)11-19/h5-13,36H,4,14H2,1-3H3,(H,31,32)(H,34,35)/t28-/m1/s1/i1D3,3D3,4D2 |
| InChIKey | OATWRUZDFPIBHF-QDMUWFNPSA-N |
| XLogP | 5.70 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |