C30H26FNO4 — CID 156877550
methyl 4-[1-(4-fluoro-3-methylphenyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]-4-oxobut-2-ynoate (PubChem CID 156877550) has the molecular formula C30H26FNO4 and a molecular weight of 483.54 g/mol. Its IUPAC name is methyl 4-[1-(4-fluoro-3-methylphenyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]-4-oxobut-2-ynoate.
| Compound Name | methyl 4-[1-(4-fluoro-3-methylphenyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]-4-oxobut-2-ynoate |
|---|---|
| PubChem CID | 156877550 |
| Molecular Formula | C30H26FNO4 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | methyl 4-[1-(4-fluoro-3-methylphenyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]-4-oxobut-2-ynoate |
| SMILES | COC(=O)C#CC(=O)c1c(C(C)C)n(-c2ccc(F)c(C)c2)c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C30H26FNO4/c1-19(2)30-29(27(33)14-15-28(34)35-4)24-17-23(36-18-21-8-6-5-7-9-21)11-13-26(24)32(30)22-10-12-25(31)20(3)16-22/h5-13,16-17,19H,18H2,1-4H3 |
| InChIKey | UZIGFSKJENEWIW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|