C35H36FNO6 — CID 156877477
dimethyl 3-[1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)-5-phenylmethoxyindol-3-yl]cyclobutane-1,1-dicarboxylate (PubChem CID 156877477) has the molecular formula C35H36FNO6 and a molecular weight of 585.67 g/mol. Its IUPAC name is dimethyl 3-[1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)-5-phenylmethoxyindol-3-yl]cyclobutane-1,1-dicarboxylate.
| Compound Name | dimethyl 3-[1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)-5-phenylmethoxyindol-3-yl]cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 156877477 |
| Molecular Formula | C35H36FNO6 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | dimethyl 3-[1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)-5-phenylmethoxyindol-3-yl]cyclobutane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(c2c(C3CCOCC3)n(-c3ccc(F)c(C)c3)c3ccc(OCc4ccccc4)cc23)C1 |
| InChI | InChI=1S/C35H36FNO6/c1-22-17-26(9-11-29(22)36)37-30-12-10-27(43-21-23-7-5-4-6-8-23)18-28(30)31(32(37)24-13-15-42-16-14-24)25-19-35(20-25,33(38)40-2)34(39)41-3/h4-12,17-18,24-25H,13-16,19-21H2,1-3H3 |
| InChIKey | FPCRMNUNAAYOQL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|