C29H27F4NO2 — CID 156878439
4-[1-(4-fluorophenyl)-4-phenylmethoxy-2-(trifluoromethyl)indol-3-yl]heptanal (PubChem CID 156878439) has the molecular formula C29H27F4NO2 and a molecular weight of 497.53 g/mol. Its IUPAC name is 4-[1-(4-fluorophenyl)-4-phenylmethoxy-2-(trifluoromethyl)indol-3-yl]heptanal.
| Compound Name | 4-[1-(4-fluorophenyl)-4-phenylmethoxy-2-(trifluoromethyl)indol-3-yl]heptanal |
|---|---|
| PubChem CID | 156878439 |
| Molecular Formula | C29H27F4NO2 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 4-[1-(4-fluorophenyl)-4-phenylmethoxy-2-(trifluoromethyl)indol-3-yl]heptanal |
| SMILES | CCCC(CCC=O)c1c(C(F)(F)F)n(-c2ccc(F)cc2)c2cccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C29H27F4NO2/c1-2-8-21(11-7-18-35)26-27-24(12-6-13-25(27)36-19-20-9-4-3-5-10-20)34(28(26)29(31,32)33)23-16-14-22(30)15-17-23/h3-6,9-10,12-18,21H,2,7-8,11,19H2,1H3 |
| InChIKey | VPOCUEZWIMOICT-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|