C21H18F4N2O4 — CID 90772220
2-[4-fluoro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]butanamide (PubChem CID 90772220) has the molecular formula C21H18F4N2O4 and a molecular weight of 438.38 g/mol. Its IUPAC name is 2-[4-fluoro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]butanamide.
| Compound Name | 2-[4-fluoro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]butanamide |
|---|---|
| PubChem CID | 90772220 |
| Molecular Formula | C21H18F4N2O4 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-[4-fluoro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]butanamide |
| SMILES | CCC(C(N)=O)c1c(C)n(C(=O)c2ccc(OC(F)(F)F)cc2)c2ccc(O)c(F)c12 |
| InChI | InChI=1S/C21H18F4N2O4/c1-3-13(19(26)29)16-10(2)27(14-8-9-15(28)18(22)17(14)16)20(30)11-4-6-12(7-5-11)31-21(23,24)25/h4-9,13,28H,3H2,1-2H3,(H2,26,29) |
| InChIKey | HWXRCLBLWBSGIR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |