C21H21ClN2O4 — CID 89057194
methyl 2-[4-amino-1-(4-chlorobenzoyl)-5-(1-hydroxyethyl)-2-methylindol-3-yl]acetate (PubChem CID 89057194) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is methyl 2-[4-amino-1-(4-chlorobenzoyl)-5-(1-hydroxyethyl)-2-methylindol-3-yl]acetate.
| Compound Name | methyl 2-[4-amino-1-(4-chlorobenzoyl)-5-(1-hydroxyethyl)-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 89057194 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | methyl 2-[4-amino-1-(4-chlorobenzoyl)-5-(1-hydroxyethyl)-2-methylindol-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(C(C)O)c(N)c12 |
| InChI | InChI=1S/C21H21ClN2O4/c1-11-16(10-18(26)28-3)19-17(9-8-15(12(2)25)20(19)23)24(11)21(27)13-4-6-14(22)7-5-13/h4-9,12,25H,10,23H2,1-3H3 |
| InChIKey | TWFYTVHLKCFVTH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|