C18H15NO4S2 — CID 90824771
2-methoxy-5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-3-yl]benzenethiol (PubChem CID 90824771) has the molecular formula C18H15NO4S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-methoxy-5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-3-yl]benzenethiol.
| Compound Name | 2-methoxy-5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-3-yl]benzenethiol |
|---|---|
| PubChem CID | 90824771 |
| Molecular Formula | C18H15NO4S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-methoxy-5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-3-yl]benzenethiol |
| SMILES | COc1ccc(-c2cc(-c3cc(OC)c4c(c3)OCO4)sn2)cc1S |
| InChI | InChI=1S/C18H15NO4S2/c1-20-13-4-3-10(7-16(13)24)12-8-17(25-19-12)11-5-14(21-2)18-15(6-11)22-9-23-18/h3-8,24H,9H2,1-2H3 |
| InChIKey | WLMINACIRVUCFC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|