C17H16N3O8P — CID 66678658
[5-methoxy-2-[5-(7-methoxy-1,3-benzodioxol-5-yl)-2H-triazol-4-yl]phenyl] dihydrogen phosphate (PubChem CID 66678658) has the molecular formula C17H16N3O8P and a molecular weight of 421.30 g/mol. Its IUPAC name is [5-methoxy-2-[5-(7-methoxy-1,3-benzodioxol-5-yl)-2H-triazol-4-yl]phenyl] dihydrogen phosphate.
| Compound Name | [5-methoxy-2-[5-(7-methoxy-1,3-benzodioxol-5-yl)-2H-triazol-4-yl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 66678658 |
| Molecular Formula | C17H16N3O8P |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | [5-methoxy-2-[5-(7-methoxy-1,3-benzodioxol-5-yl)-2H-triazol-4-yl]phenyl] dihydrogen phosphate |
| SMILES | COc1ccc(-c2n[nH]nc2-c2cc(OC)c3c(c2)OCO3)c(OP(=O)(O)O)c1 |
| InChI | InChI=1S/C17H16N3O8P/c1-24-10-3-4-11(12(7-10)28-29(21,22)23)16-15(18-20-19-16)9-5-13(25-2)17-14(6-9)26-8-27-17/h3-7H,8H2,1-2H3,(H,18,19,20)(H2,21,22,23) |
| InChIKey | BQQDIUBXUCMEAP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|