C18H21N3NaO8P — CID 173007649
sodium;hydride;[5-methoxy-2-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl] dihydrogen phosphate (PubChem CID 173007649) has the molecular formula C18H21N3NaO8P and a molecular weight of 461.34 g/mol. Its IUPAC name is sodium;hydride;[5-methoxy-2-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl] dihydrogen phosphate.
| Compound Name | sodium;hydride;[5-methoxy-2-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 173007649 |
| Molecular Formula | C18H21N3NaO8P |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | sodium;hydride;[5-methoxy-2-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl] dihydrogen phosphate |
| SMILES | COc1ccc(-c2n[nH]nc2-c2cc(OC)c(OC)c(OC)c2)c(OP(=O)(O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C18H20N3O8P.Na.H/c1-25-11-5-6-12(13(9-11)29-30(22,23)24)17-16(19-21-20-17)10-7-14(26-2)18(28-4)15(8-10)27-3;;/h5-9H,1-4H3,(H,19,20,21)(H2,22,23,24);;/q;+1;-1 |
| InChIKey | RYNYYKVGFQFMFQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|