C20H22NO9P — CID 58178345
[5-[3-(3,4-dimethoxy-5-methylphenyl)-1,2-oxazol-4-yl]-2,3-dimethoxyphenyl] dihydrogen phosphate (PubChem CID 58178345) has the molecular formula C20H22NO9P and a molecular weight of 451.37 g/mol. Its IUPAC name is [5-[3-(3,4-dimethoxy-5-methylphenyl)-1,2-oxazol-4-yl]-2,3-dimethoxyphenyl] dihydrogen phosphate.
| Compound Name | [5-[3-(3,4-dimethoxy-5-methylphenyl)-1,2-oxazol-4-yl]-2,3-dimethoxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58178345 |
| Molecular Formula | C20H22NO9P |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | [5-[3-(3,4-dimethoxy-5-methylphenyl)-1,2-oxazol-4-yl]-2,3-dimethoxyphenyl] dihydrogen phosphate |
| SMILES | COc1cc(-c2nocc2-c2cc(OC)c(OC)c(OP(=O)(O)O)c2)cc(C)c1OC |
| InChI | InChI=1S/C20H22NO9P/c1-11-6-13(9-15(25-2)19(11)27-4)18-14(10-29-21-18)12-7-16(26-3)20(28-5)17(8-12)30-31(22,23)24/h6-10H,1-5H3,(H2,22,23,24) |
| InChIKey | CCINQSGSGJEORB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 129.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|