C22H26N4O7 — CID 59430320
2-methoxyethyl N-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl]carbamate (PubChem CID 59430320) has the molecular formula C22H26N4O7 and a molecular weight of 458.47 g/mol. Its IUPAC name is 2-methoxyethyl N-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 59430320 |
| Molecular Formula | C22H26N4O7 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 2-methoxyethyl N-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1cc(-c2n[nH]nc2-c2cc(OC)c(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C22H26N4O7/c1-28-8-9-33-22(27)23-15-10-13(6-7-16(15)29-2)19-20(25-26-24-19)14-11-17(30-3)21(32-5)18(12-14)31-4/h6-7,10-12H,8-9H2,1-5H3,(H,23,27)(H,24,25,26) |
| InChIKey | VZXRAMUBXLSQOK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|