C19H20N4O6 — CID 87507855
methoxy-[3-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl]carbamic acid (PubChem CID 87507855) has the molecular formula C19H20N4O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is methoxy-[3-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl]carbamic acid.
| Compound Name | methoxy-[3-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 87507855 |
| Molecular Formula | C19H20N4O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | methoxy-[3-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenyl]carbamic acid |
| SMILES | COc1cc(-c2n[nH]nc2-c2cccc(N(OC)C(=O)O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N4O6/c1-26-14-9-12(10-15(27-2)18(14)28-3)17-16(20-22-21-17)11-6-5-7-13(8-11)23(29-4)19(24)25/h5-10H,1-4H3,(H,24,25)(H,20,21,22) |
| InChIKey | RODYIAKIKXMCMU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|