C17H16N3NaO4 — CID 66678861
sodium 4-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenolate (PubChem CID 66678861) has the molecular formula C17H16N3NaO4 and a molecular weight of 349.32 g/mol. Its IUPAC name is sodium 4-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenolate.
| Compound Name | sodium 4-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenolate |
|---|---|
| PubChem CID | 66678861 |
| Molecular Formula | C17H16N3NaO4 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | sodium 4-[5-(3,4,5-trimethoxyphenyl)-2H-triazol-4-yl]phenolate |
| SMILES | COc1cc(-c2n[nH]nc2-c2ccc([O-])cc2)cc(OC)c1OC.[Na+] |
| InChI | InChI=1S/C17H17N3O4.Na/c1-22-13-8-11(9-14(23-2)17(13)24-3)16-15(18-20-19-16)10-4-6-12(21)7-5-10;/h4-9,21H,1-3H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | BOIGDTDDTGAZNQ-UHFFFAOYSA-M |
| XLogP | -0.76 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |