C19H20N3O10P — CID 163743478
diamino [2,3-dimethoxy-5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenyl] phosphate (PubChem CID 163743478) has the molecular formula C19H20N3O10P and a molecular weight of 481.35 g/mol. Its IUPAC name is diamino [2,3-dimethoxy-5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenyl] phosphate.
| Compound Name | diamino [2,3-dimethoxy-5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenyl] phosphate |
|---|---|
| PubChem CID | 163743478 |
| Molecular Formula | C19H20N3O10P |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | diamino [2,3-dimethoxy-5-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]phenyl] phosphate |
| SMILES | COc1cc(-c2cnoc2-c2cc(OC)c3c(c2)OCO3)cc(OP(=O)(ON)ON)c1OC |
| InChI | InChI=1S/C19H20N3O10P/c1-24-13-4-10(5-16(18(13)26-3)30-33(23,31-20)32-21)12-8-22-29-17(12)11-6-14(25-2)19-15(7-11)27-9-28-19/h4-8H,9,20-21H2,1-3H3 |
| InChIKey | OOKFAYSLPQKLLI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 168.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|