C17H20N5O7PS+2 — CID 163609797
[azaniumyloxy-[5-[3-(7-methoxy-1,3-benzodioxol-5-yl)triazol-4-yl]-2-methylsulfanylphenoxy]phosphoryl]oxyazanium (PubChem CID 163609797) has the molecular formula C17H20N5O7PS+2 and a molecular weight of 469.42 g/mol. Its IUPAC name is [azaniumyloxy-[5-[3-(7-methoxy-1,3-benzodioxol-5-yl)triazol-4-yl]-2-methylsulfanylphenoxy]phosphoryl]oxyazanium.
| Compound Name | [azaniumyloxy-[5-[3-(7-methoxy-1,3-benzodioxol-5-yl)triazol-4-yl]-2-methylsulfanylphenoxy]phosphoryl]oxyazanium |
|---|---|
| PubChem CID | 163609797 |
| Molecular Formula | C17H20N5O7PS+2 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | [azaniumyloxy-[5-[3-(7-methoxy-1,3-benzodioxol-5-yl)triazol-4-yl]-2-methylsulfanylphenoxy]phosphoryl]oxyazanium |
| SMILES | COc1cc(-n2nncc2-c2ccc(SC)c(OP(=O)(O[NH3+])O[NH3+])c2)cc2c1OCO2 |
| InChI | InChI=1S/C17H20N5O7PS/c1-24-14-6-11(7-15-17(14)26-9-25-15)22-12(8-20-21-22)10-3-4-16(31-2)13(5-10)27-30(23,28-18)29-19/h3-8H,9H2,1-2,18-19H3/q+2 |
| InChIKey | HEXWQLAYTWWWRW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|