C18H17O4+ — CID 140893892
[2-(3,4-dimethoxyphenyl)chromenylium-7-yl]methanol (PubChem CID 140893892) has the molecular formula C18H17O4+ and a molecular weight of 297.33 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)chromenylium-7-yl]methanol.
| Compound Name | [2-(3,4-dimethoxyphenyl)chromenylium-7-yl]methanol |
|---|---|
| PubChem CID | 140893892 |
| Molecular Formula | C18H17O4+ |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)chromenylium-7-yl]methanol |
| SMILES | COc1ccc(-c2ccc3ccc(CO)cc3[o+]2)cc1OC |
| InChI | InChI=1S/C18H17O4/c1-20-16-8-6-14(10-18(16)21-2)15-7-5-13-4-3-12(11-19)9-17(13)22-15/h3-10,19H,11H2,1-2H3/q+1 |
| InChIKey | SKQCEPQZVNKARI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|