C19H19ClO9 — CID 13045836
2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromenylium perchlorate (PubChem CID 13045836) has the molecular formula C19H19ClO9 and a molecular weight of 426.81 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromenylium perchlorate.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromenylium perchlorate |
|---|---|
| PubChem CID | 13045836 |
| Molecular Formula | C19H19ClO9 |
| Molecular Weight | 426.81 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromenylium perchlorate |
| SMILES | COc1cc(OC)c2ccc(-c3ccc(OC)c(OC)c3)[o+]c2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C19H19O5.ClHO4/c1-20-13-10-17(22-3)14-6-8-15(24-18(14)11-13)12-5-7-16(21-2)19(9-12)23-4;2-1(3,4)5/h5-11H,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | CCCYCNFTSVBJQB-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 140.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.81 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|