C18H16O3 — CID 56648124
6-(3,4-dimethoxyphenyl)naphthalen-1-ol (PubChem CID 56648124) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)naphthalen-1-ol.
| Compound Name | 6-(3,4-dimethoxyphenyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 56648124 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)naphthalen-1-ol |
| SMILES | COc1ccc(-c2ccc3c(O)cccc3c2)cc1OC |
| InChI | InChI=1S/C18H16O3/c1-20-17-9-7-13(11-18(17)21-2)12-6-8-15-14(10-12)4-3-5-16(15)19/h3-11,19H,1-2H3 |
| InChIKey | IAIGVBSZDHGXIG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |