C15H17NO2 — CID 21258113
1-[1-(7-methoxy-1-benzofuran-2-yl)ethenyl]pyrrolidine (PubChem CID 21258113) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-[1-(7-methoxy-1-benzofuran-2-yl)ethenyl]pyrrolidine.
| Compound Name | 1-[1-(7-methoxy-1-benzofuran-2-yl)ethenyl]pyrrolidine |
|---|---|
| PubChem CID | 21258113 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-[1-(7-methoxy-1-benzofuran-2-yl)ethenyl]pyrrolidine |
| SMILES | C=C(c1cc2cccc(OC)c2o1)N1CCCC1 |
| InChI | InChI=1S/C15H17NO2/c1-11(16-8-3-4-9-16)14-10-12-6-5-7-13(17-2)15(12)18-14/h5-7,10H,1,3-4,8-9H2,2H3 |
| InChIKey | DCQWQHKLFSYKJF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |