C23H31N3O3 — CID 126892491
[3-(4-cyclohexylpiperazin-1-yl)azetidin-1-yl]-(7-methoxy-1-benzofuran-2-yl)methanone (PubChem CID 126892491) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is [3-(4-cyclohexylpiperazin-1-yl)azetidin-1-yl]-(7-methoxy-1-benzofuran-2-yl)methanone.
| Compound Name | [3-(4-cyclohexylpiperazin-1-yl)azetidin-1-yl]-(7-methoxy-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 126892491 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | [3-(4-cyclohexylpiperazin-1-yl)azetidin-1-yl]-(7-methoxy-1-benzofuran-2-yl)methanone |
| SMILES | COc1cccc2cc(C(=O)N3CC(N4CCN(C5CCCCC5)CC4)C3)oc12 |
| InChI | InChI=1S/C23H31N3O3/c1-28-20-9-5-6-17-14-21(29-22(17)20)23(27)26-15-19(16-26)25-12-10-24(11-13-25)18-7-3-2-4-8-18/h5-6,9,14,18-19H,2-4,7-8,10-13,15-16H2,1H3 |
| InChIKey | UENMNPALZMISQW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |