C19H16ClNO5S — CID 90594882
[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-(7-methoxy-1-benzofuran-2-yl)methanone (PubChem CID 90594882) has the molecular formula C19H16ClNO5S and a molecular weight of 405.86 g/mol. Its IUPAC name is [3-(4-chlorophenyl)sulfonylazetidin-1-yl]-(7-methoxy-1-benzofuran-2-yl)methanone.
| Compound Name | [3-(4-chlorophenyl)sulfonylazetidin-1-yl]-(7-methoxy-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 90594882 |
| Molecular Formula | C19H16ClNO5S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | [3-(4-chlorophenyl)sulfonylazetidin-1-yl]-(7-methoxy-1-benzofuran-2-yl)methanone |
| SMILES | COc1cccc2cc(C(=O)N3CC(S(=O)(=O)c4ccc(Cl)cc4)C3)oc12 |
| InChI | InChI=1S/C19H16ClNO5S/c1-25-16-4-2-3-12-9-17(26-18(12)16)19(22)21-10-15(11-21)27(23,24)14-7-5-13(20)6-8-14/h2-9,15H,10-11H2,1H3 |
| InChIKey | LEVGBGPICSPQHF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |