C20H27ClN2O3 — CID 18456501
(4-cyclopentylpiperazin-1-yl)-(7-ethoxy-1-benzofuran-2-yl)methanone;hydrochloride (PubChem CID 18456501) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is (4-cyclopentylpiperazin-1-yl)-(7-ethoxy-1-benzofuran-2-yl)methanone;hydrochloride.
| Compound Name | (4-cyclopentylpiperazin-1-yl)-(7-ethoxy-1-benzofuran-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 18456501 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (4-cyclopentylpiperazin-1-yl)-(7-ethoxy-1-benzofuran-2-yl)methanone;hydrochloride |
| SMILES | CCOc1cccc2cc(C(=O)N3CCN(C4CCCC4)CC3)oc12.Cl |
| InChI | InChI=1S/C20H26N2O3.ClH/c1-2-24-17-9-5-6-15-14-18(25-19(15)17)20(23)22-12-10-21(11-13-22)16-7-3-4-8-16;/h5-6,9,14,16H,2-4,7-8,10-13H2,1H3;1H |
| InChIKey | FSVNREBCOYBAQN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |