C17H17ClN2O2 — CID 67238737
4-chloro-N-[4-(4-hydroxypyrrolidin-3-yl)phenyl]benzamide (PubChem CID 67238737) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is 4-chloro-N-[4-(4-hydroxypyrrolidin-3-yl)phenyl]benzamide.
| Compound Name | 4-chloro-N-[4-(4-hydroxypyrrolidin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 67238737 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-chloro-N-[4-(4-hydroxypyrrolidin-3-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C2CNCC2O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2O2/c18-13-5-1-12(2-6-13)17(22)20-14-7-3-11(4-8-14)15-9-19-10-16(15)21/h1-8,15-16,19,21H,9-10H2,(H,20,22) |
| InChIKey | KJUMFGHKFBIFOX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |