C15H12Cl2S — CID 54133109
6-chloro-2-(4-chlorophenyl)-3,4-dihydro-2H-thiochromene (PubChem CID 54133109) has the molecular formula C15H12Cl2S and a molecular weight of 295.23 g/mol. Its IUPAC name is 6-chloro-2-(4-chlorophenyl)-3,4-dihydro-2H-thiochromene.
| Compound Name | 6-chloro-2-(4-chlorophenyl)-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 54133109 |
| Molecular Formula | C15H12Cl2S |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 6-chloro-2-(4-chlorophenyl)-3,4-dihydro-2H-thiochromene |
| SMILES | Clc1ccc(C2CCc3cc(Cl)ccc3S2)cc1 |
| InChI | InChI=1S/C15H12Cl2S/c16-12-4-1-10(2-5-12)14-7-3-11-9-13(17)6-8-15(11)18-14/h1-2,4-6,8-9,14H,3,7H2 |
| InChIKey | NVTANGHJMGKCTM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |