C15H12BrFO3S3 — CID 60609560
[4-(1,3-dithiolan-2-yl)phenyl] 5-bromo-2-fluorobenzenesulfonate (PubChem CID 60609560) has the molecular formula C15H12BrFO3S3 and a molecular weight of 435.36 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)phenyl] 5-bromo-2-fluorobenzenesulfonate.
| Compound Name | [4-(1,3-dithiolan-2-yl)phenyl] 5-bromo-2-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 60609560 |
| Molecular Formula | C15H12BrFO3S3 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 433.91 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)phenyl] 5-bromo-2-fluorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C2SCCS2)cc1)c1cc(Br)ccc1F |
| InChI | InChI=1S/C15H12BrFO3S3/c16-11-3-6-13(17)14(9-11)23(18,19)20-12-4-1-10(2-5-12)15-21-7-8-22-15/h1-6,9,15H,7-8H2 |
| InChIKey | YCBUVKOOUZQRTO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|