C19H17BrO2S2 — CID 164827592
[4-(1,3-dithian-2-yl)phenyl] (E)-3-(4-bromophenyl)prop-2-enoate (PubChem CID 164827592) has the molecular formula C19H17BrO2S2 and a molecular weight of 421.38 g/mol. Its IUPAC name is [4-(1,3-dithian-2-yl)phenyl] (E)-3-(4-bromophenyl)prop-2-enoate.
| Compound Name | [4-(1,3-dithian-2-yl)phenyl] (E)-3-(4-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 164827592 |
| Molecular Formula | C19H17BrO2S2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | [4-(1,3-dithian-2-yl)phenyl] (E)-3-(4-bromophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Br)cc1)Oc1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C19H17BrO2S2/c20-16-7-2-14(3-8-16)4-11-18(21)22-17-9-5-15(6-10-17)19-23-12-1-13-24-19/h2-11,19H,1,12-13H2/b11-4+ |
| InChIKey | MPHRTQAPRQIGAI-NYYWCZLTSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|