C20H20O4S2 — CID 7997515
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] (E)-3-(3-methoxyphenyl)prop-2-enoate (PubChem CID 7997515) has the molecular formula C20H20O4S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] (E)-3-(3-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] (E)-3-(3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7997515 |
| Molecular Formula | C20H20O4S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] (E)-3-(3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)Oc2ccc(C3SCCS3)cc2OC)c1 |
| InChI | InChI=1S/C20H20O4S2/c1-22-16-5-3-4-14(12-16)6-9-19(21)24-17-8-7-15(13-18(17)23-2)20-25-10-11-26-20/h3-9,12-13,20H,10-11H2,1-2H3/b9-6+ |
| InChIKey | KDPNGBMASJGYAC-RMKNXTFCSA-N |
| XLogP | 4.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|