C19H19NO3S2 — CID 164827641
[2-(1,3-dithian-2-yl)-4-methoxyphenyl] (Z)-3-pyridin-4-ylprop-2-enoate (PubChem CID 164827641) has the molecular formula C19H19NO3S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is [2-(1,3-dithian-2-yl)-4-methoxyphenyl] (Z)-3-pyridin-4-ylprop-2-enoate.
| Compound Name | [2-(1,3-dithian-2-yl)-4-methoxyphenyl] (Z)-3-pyridin-4-ylprop-2-enoate |
|---|---|
| PubChem CID | 164827641 |
| Molecular Formula | C19H19NO3S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | [2-(1,3-dithian-2-yl)-4-methoxyphenyl] (Z)-3-pyridin-4-ylprop-2-enoate |
| SMILES | COc1ccc(OC(=O)/C=C\c2ccncc2)c(C2SCCCS2)c1 |
| InChI | InChI=1S/C19H19NO3S2/c1-22-15-4-5-17(16(13-15)19-24-11-2-12-25-19)23-18(21)6-3-14-7-9-20-10-8-14/h3-10,13,19H,2,11-12H2,1H3/b6-3- |
| InChIKey | IKRGBFCOCKNMAO-UTCJRWHESA-N |
| XLogP | 4.58 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|