C14H14O3S2 — CID 47109815
2,3-dihydro-1H-inden-5-yl 5-methylthiophene-2-sulfonate (PubChem CID 47109815) has the molecular formula C14H14O3S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl 5-methylthiophene-2-sulfonate.
| Compound Name | 2,3-dihydro-1H-inden-5-yl 5-methylthiophene-2-sulfonate |
|---|---|
| PubChem CID | 47109815 |
| Molecular Formula | C14H14O3S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl 5-methylthiophene-2-sulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3c(c2)CCC3)s1 |
| InChI | InChI=1S/C14H14O3S2/c1-10-5-8-14(18-10)19(15,16)17-13-7-6-11-3-2-4-12(11)9-13/h5-9H,2-4H2,1H3 |
| InChIKey | XCBKSOVMLJMOFV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|