C18H18O3P+ — CID 23365116
bis(2,3-dihydro-1H-inden-5-yloxy)-oxophosphanium (PubChem CID 23365116) has the molecular formula C18H18O3P+ and a molecular weight of 313.31 g/mol. Its IUPAC name is bis(2,3-dihydro-1H-inden-5-yloxy)-oxophosphanium.
| Compound Name | bis(2,3-dihydro-1H-inden-5-yloxy)-oxophosphanium |
|---|---|
| PubChem CID | 23365116 |
| Molecular Formula | C18H18O3P+ |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | bis(2,3-dihydro-1H-inden-5-yloxy)-oxophosphanium |
| SMILES | O=[P+](Oc1ccc2c(c1)CCC2)Oc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H18O3P/c19-22(20-17-9-7-13-3-1-5-15(13)11-17)21-18-10-8-14-4-2-6-16(14)12-18/h7-12H,1-6H2/q+1 |
| InChIKey | PPZAEMLKPDCCHU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|