C12H14O — CID 643900
5-[(Z)-prop-1-enoxy]-2,3-dihydro-1H-indene (PubChem CID 643900) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 5-[(Z)-prop-1-enoxy]-2,3-dihydro-1H-indene.
| Compound Name | 5-[(Z)-prop-1-enoxy]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 643900 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 5-[(Z)-prop-1-enoxy]-2,3-dihydro-1H-indene |
| SMILES | C/C=C\Oc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H14O/c1-2-8-13-12-7-6-10-4-3-5-11(10)9-12/h2,6-9H,3-5H2,1H3/b8-2- |
| InChIKey | CRKIMQJUFWQMGT-WAPJZHGLSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|