C10H13P — CID 166765360
2,3-dihydro-1H-inden-5-yl(methyl)phosphane (PubChem CID 166765360) has the molecular formula C10H13P and a molecular weight of 164.19 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl(methyl)phosphane.
| Compound Name | 2,3-dihydro-1H-inden-5-yl(methyl)phosphane |
|---|---|
| PubChem CID | 166765360 |
| Molecular Formula | C10H13P |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl(methyl)phosphane |
| SMILES | CPc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H13P/c1-11-10-6-5-8-3-2-4-9(8)7-10/h5-7,11H,2-4H2,1H3 |
| InChIKey | DTBQIRMNIOFHAC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|