C11H16N2 — CID 115226489
N'-(2,3-dihydro-1H-inden-5-yl)-N-methylmethanediamine (PubChem CID 115226489) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N'-(2,3-dihydro-1H-inden-5-yl)-N-methylmethanediamine.
| Compound Name | N'-(2,3-dihydro-1H-inden-5-yl)-N-methylmethanediamine |
|---|---|
| PubChem CID | 115226489 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N'-(2,3-dihydro-1H-inden-5-yl)-N-methylmethanediamine |
| SMILES | CNCNc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C11H16N2/c1-12-8-13-11-6-5-9-3-2-4-10(9)7-11/h5-7,12-13H,2-4,8H2,1H3 |
| InChIKey | ALLOYEYXQRUMAI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|