C13H17NO2 — CID 127549123
2,3-dihydro-1H-inden-5-yl N-propan-2-ylcarbamate (PubChem CID 127549123) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl N-propan-2-ylcarbamate.
| Compound Name | 2,3-dihydro-1H-inden-5-yl N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 127549123 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)Oc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H17NO2/c1-9(2)14-13(15)16-12-7-6-10-4-3-5-11(10)8-12/h6-9H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | DLVNBIWUTJFNET-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |