C14H19NO2 — CID 82116252
2,3-dihydro-1H-inden-5-yl 2-amino-3-methylbutanoate (PubChem CID 82116252) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl 2-amino-3-methylbutanoate.
| Compound Name | 2,3-dihydro-1H-inden-5-yl 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 82116252 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)Oc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H19NO2/c1-9(2)13(15)14(16)17-12-7-6-10-4-3-5-11(10)8-12/h6-9,13H,3-5,15H2,1-2H3 |
| InChIKey | JLZFZUTWIXNNRX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|