C10H11FO2S — CID 82284501
5,6,7,8-tetrahydronaphthalene-2-sulfonyl fluoride (PubChem CID 82284501) has the molecular formula C10H11FO2S and a molecular weight of 214.26 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalene-2-sulfonyl fluoride.
| Compound Name | 5,6,7,8-tetrahydronaphthalene-2-sulfonyl fluoride |
|---|---|
| PubChem CID | 82284501 |
| Molecular Formula | C10H11FO2S |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalene-2-sulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H11FO2S/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h5-7H,1-4H2 |
| InChIKey | AXVFYSMGIXYXMB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |