C21H17N3O2 — CID 134798841
N-(2-phenylethyl)-2-pyridin-2-yl-1,3-benzoxazole-6-carboxamide (PubChem CID 134798841) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-pyridin-2-yl-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-(2-phenylethyl)-2-pyridin-2-yl-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 134798841 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-(2-phenylethyl)-2-pyridin-2-yl-1,3-benzoxazole-6-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc2nc(-c3ccccn3)oc2c1 |
| InChI | InChI=1S/C21H17N3O2/c25-20(23-13-11-15-6-2-1-3-7-15)16-9-10-17-19(14-16)26-21(24-17)18-8-4-5-12-22-18/h1-10,12,14H,11,13H2,(H,23,25) |
| InChIKey | YBRDZIJIWUVTCK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |