C21H18N2O2S — CID 53089382
2-benzyl-N-(2-thiophen-2-ylethyl)-1,3-benzoxazole-6-carboxamide (PubChem CID 53089382) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-benzyl-N-(2-thiophen-2-ylethyl)-1,3-benzoxazole-6-carboxamide.
| Compound Name | 2-benzyl-N-(2-thiophen-2-ylethyl)-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 53089382 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-benzyl-N-(2-thiophen-2-ylethyl)-1,3-benzoxazole-6-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1ccc2nc(Cc3ccccc3)oc2c1 |
| InChI | InChI=1S/C21H18N2O2S/c24-21(22-11-10-17-7-4-12-26-17)16-8-9-18-19(14-16)25-20(23-18)13-15-5-2-1-3-6-15/h1-9,12,14H,10-11,13H2,(H,22,24) |
| InChIKey | DZONYYCRNYNTDR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |