C21H18N4O5 — CID 100624637
N-[3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propyl]-2-phenyl-1,3-benzoxazole-6-carboxamide (PubChem CID 100624637) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is N-[3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propyl]-2-phenyl-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-[3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propyl]-2-phenyl-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 100624637 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propyl]-2-phenyl-1,3-benzoxazole-6-carboxamide |
| SMILES | CN1C(=O)C(=O)N(CCCNC(=O)c2ccc3nc(-c4ccccc4)oc3c2)C1=O |
| InChI | InChI=1S/C21H18N4O5/c1-24-19(27)20(28)25(21(24)29)11-5-10-22-17(26)14-8-9-15-16(12-14)30-18(23-15)13-6-3-2-4-7-13/h2-4,6-9,12H,5,10-11H2,1H3,(H,22,26) |
| InChIKey | FXWNSTZDPZKCSX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|