C13H10N2O3 — CID 138543177
2-(1-methylpyrrol-3-yl)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 138543177) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-(1-methylpyrrol-3-yl)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(1-methylpyrrol-3-yl)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 138543177 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-(1-methylpyrrol-3-yl)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | Cn1ccc(-c2nc3ccc(C(=O)O)cc3o2)c1 |
| InChI | InChI=1S/C13H10N2O3/c1-15-5-4-9(7-15)12-14-10-3-2-8(13(16)17)6-11(10)18-12/h2-7H,1H3,(H,16,17) |
| InChIKey | WMRMIGJCEWUEGK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |