2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid

C12H8N2O3S — CID 81357317

IUPAC2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid
SMILESCc1nc(-c2nc3ccc(C(=O)O)cc3o2)cs1
InChIInChI=1S/C12H8N2O3S/c1-6-13-9(5-18-6)11-14-8-3-2-7(12(15)16)4-10(8)17-11/h2-5H,1H3,(H,15,16)
InChIKeyNQGVUNNQBPTKSZ-UHFFFAOYSA-N
MW260.27 g/mol
LogP2.96
Rot. Bonds2

About 2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid

2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 81357317) has the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid.

Molecular Properties

Compound Name2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid
PubChem CID81357317
Molecular FormulaC12H8N2O3S
Molecular Weight260.27 g/mol
Exact Mass260.03
IUPAC Name2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid
SMILESCc1nc(-c2nc3ccc(C(=O)O)cc3o2)cs1
InChIInChI=1S/C12H8N2O3S/c1-6-13-9(5-18-6)11-14-8-3-2-7(12(15)16)4-10(8)17-11/h2-5H,1H3,(H,15,16)
InChIKeyNQGVUNNQBPTKSZ-UHFFFAOYSA-N
XLogP2.96
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.27
LogP ≤ 52.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid?
The IUPAC name of 2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid (CID 81357317) is 2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid.
What is the SMILES notation for 2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid?
The canonical SMILES for 2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid is Cc1nc(-c2nc3ccc(C(=O)O)cc3o2)cs1.
What is the InChIKey of 2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid?
The InChIKey is NQGVUNNQBPTKSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O3S/c1-6-13-9(5-18-6)11-14-8-3-2-7(12(15)16)4-10(8)17-11/h2-5H,1H3,(H,15,16).
What are the key properties of 2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid?
2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid has a molecular weight of 260.27 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-thiazol-4-yl)-1,3-benzoxazole-6-carboxylic acid is sourced from PubChem (CID 81357317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).