C22H22N2O5S — CID 19041001
2-[[4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoyl]amino]acetic acid (PubChem CID 19041001) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is 2-[[4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 19041001 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[[4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoyl]amino]acetic acid |
| SMILES | CCOc1ccc(-c2nc(-c3ccc(C(=O)NCC(=O)O)cc3)cs2)cc1OCC |
| InChI | InChI=1S/C22H22N2O5S/c1-3-28-18-10-9-16(11-19(18)29-4-2)22-24-17(13-30-22)14-5-7-15(8-6-14)21(27)23-12-20(25)26/h5-11,13H,3-4,12H2,1-2H3,(H,23,27)(H,25,26) |
| InChIKey | WWKSVUXJKHPTHC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |