C16H19NO4S — CID 175274809
[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl] propanoate (PubChem CID 175274809) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is [2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl] propanoate.
| Compound Name | [2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl] propanoate |
|---|---|
| PubChem CID | 175274809 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | [2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl] propanoate |
| SMILES | CCOc1ccc(-c2nc(OC(=O)CC)cs2)cc1OCC |
| InChI | InChI=1S/C16H19NO4S/c1-4-15(18)21-14-10-22-16(17-14)11-7-8-12(19-5-2)13(9-11)20-6-3/h7-10H,4-6H2,1-3H3 |
| InChIKey | QSTUMZUDEDGPDE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |