C23H24N2O4S — CID 68709034
1-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-3-(3-ethoxy-2-pyridinyl)prop-2-en-1-one (PubChem CID 68709034) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-3-(3-ethoxy-2-pyridinyl)prop-2-en-1-one.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-3-(3-ethoxy-2-pyridinyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68709034 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-3-(3-ethoxy-2-pyridinyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(-c2nc(C(=O)C=Cc3ncccc3OCC)cs2)cc1OCC |
| InChI | InChI=1S/C23H24N2O4S/c1-4-27-20-8-7-13-24-17(20)10-11-19(26)18-15-30-23(25-18)16-9-12-21(28-5-2)22(14-16)29-6-3/h7-15H,4-6H2,1-3H3 |
| InChIKey | HIJRMDMFNIEMGI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|