C23H23NO5S — CID 18707267
3-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-4-hydroxy-5-prop-2-enylbenzoic acid (PubChem CID 18707267) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-4-hydroxy-5-prop-2-enylbenzoic acid.
| Compound Name | 3-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-4-hydroxy-5-prop-2-enylbenzoic acid |
|---|---|
| PubChem CID | 18707267 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 3-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-4-hydroxy-5-prop-2-enylbenzoic acid |
| SMILES | C=CCc1cc(C(=O)O)cc(-c2csc(-c3ccc(OCC)c(OCC)c3)n2)c1O |
| InChI | InChI=1S/C23H23NO5S/c1-4-7-14-10-16(23(26)27)11-17(21(14)25)18-13-30-22(24-18)15-8-9-19(28-5-2)20(12-15)29-6-3/h4,8-13,25H,1,5-7H2,2-3H3,(H,26,27) |
| InChIKey | LXRWOVJDKYVXOG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|