C26H29NO7S — CID 18707389
methoxymethyl 5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-3-ethenyl-2-(methoxymethoxy)benzoate (PubChem CID 18707389) has the molecular formula C26H29NO7S and a molecular weight of 499.59 g/mol. Its IUPAC name is methoxymethyl 5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-3-ethenyl-2-(methoxymethoxy)benzoate.
| Compound Name | methoxymethyl 5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-3-ethenyl-2-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 18707389 |
| Molecular Formula | C26H29NO7S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | methoxymethyl 5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-3-ethenyl-2-(methoxymethoxy)benzoate |
| SMILES | C=Cc1cc(-c2csc(-c3ccc(OCC)c(OCC)c3)n2)cc(C(=O)OCOC)c1OCOC |
| InChI | InChI=1S/C26H29NO7S/c1-6-17-11-19(12-20(24(17)33-15-29-4)26(28)34-16-30-5)21-14-35-25(27-21)18-9-10-22(31-7-2)23(13-18)32-8-3/h6,9-14H,1,7-8,15-16H2,2-5H3 |
| InChIKey | VKQUSTQNJFLECA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 85.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|