C24H25NO5S — CID 18707195
5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-2-hydroxy-3-(2-methylprop-2-enyl)benzoic acid (PubChem CID 18707195) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is 5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-2-hydroxy-3-(2-methylprop-2-enyl)benzoic acid.
| Compound Name | 5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-2-hydroxy-3-(2-methylprop-2-enyl)benzoic acid |
|---|---|
| PubChem CID | 18707195 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-2-hydroxy-3-(2-methylprop-2-enyl)benzoic acid |
| SMILES | C=C(C)Cc1cc(-c2csc(-c3ccc(OCC)c(OCC)c3)n2)cc(C(=O)O)c1O |
| InChI | InChI=1S/C24H25NO5S/c1-5-29-20-8-7-15(12-21(20)30-6-2)23-25-19(13-31-23)16-10-17(9-14(3)4)22(26)18(11-16)24(27)28/h7-8,10-13,26H,3,5-6,9H2,1-2,4H3,(H,27,28) |
| InChIKey | PABWGWIVIPWQLY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|